Tradlon Chemical Co., Ltd.
Mobile: +86-13367102998
E-mail: xf_sdj001@sina.com
tradlonchem@163.com
Add: 83 Panggong Road, Xiangcheng District, Xiangyang City, Hubei, China
Product
4,4'-Dihydroxybenzophenone
Name: 4,4'-Dihydroxybenzophenone
| English name: | 4,4'-Dihydroxybenzophenone | |
| CAS NO: | 611-99-4 | |
| Molecular weight: | 214.2167 | |
| EC NO: | 210-288-1 | |
| Molecular formula: | C13H10O3 | |
| InChI: | InChI=1/C13H10O3/c14-11-5-1-9(2-6-11)13(16)10-3-7-12(15)8-4-10/h1-8,14-15H | |
| Alias: | DHBP; 4,4-Dihydroxybenzophenone; bis(4-hydroxyphenyl)methanone; 4,4'-Dihydroxy benzophenone | |
| Structural formula: | ![]() |
|

